CAS 30066-26-3 appears in our catalog under these names: 3-Amino-3-phenylpropanamide hydrochloride, 3-Amino-3-phenylpropanamide hydrochloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 250mg, 5g, 1g, 10g, 100mg.
3-amino-3-phenylpropanamide;hydrochloride (CAS 30066-26-3) is a chemical compound with the molecular formula C9H13ClN2O and a molecular weight of 200.66 g/mol. IUPAC name: 3-amino-3-phenylpropanamide;hydrochloride. InChIKey: ACPHHKOHQJYZRF-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | 3-amino-3-phenylpropanamide;hydrochloride |
| InChIKey | ACPHHKOHQJYZRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(=O)N)N.Cl |
Computed by PubChem (NCBI)