Products 51802-83-6

CAS 51802-83-6 is the registry number for 5-(Chloromethyl)-3-cyclohexyl-1,2,4-oxadiazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

5-(chloromethyl)-3-cyclohexyl-1,2,4-oxadiazole (CAS 51802-83-6) is a chemical compound with the molecular formula C9H13ClN2O and a molecular weight of 200.66 g/mol. IUPAC name: 5-(chloromethyl)-3-cyclohexyl-1,2,4-oxadiazole. InChIKey: DNFZHBNBPDPDNZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13ClN2O
Molecular weight200.66 g/mol
IUPAC name5-(chloromethyl)-3-cyclohexyl-1,2,4-oxadiazole
InChIKeyDNFZHBNBPDPDNZ-UHFFFAOYSA-N
SMILESC1CCC(CC1)C2=NOC(=N2)CCl

Computed by PubChem (NCBI)