Products 153973-14-9
CAS 153973-14-9 appears in our catalog under these names: 2-Amino-n-phenylpropanamide hydrochloride, 95%, 2-Amino-N-phenylpropanamide hydrochloride, 95+%, 2-Amino-N-phenylpropanamide hydrochloride, 2-Amino-N-phenylpropanamide (hydrochloride), 99.0%. Offered by: Combi-blocks, AmBeed, Biosynth, MedChemExpress. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g, Get quote.
2-amino-N-phenylpropanamide;hydrochloride (CAS 153973-14-9) is a chemical compound with the molecular formula C9H13ClN2O and a molecular weight of 200.66 g/mol. IUPAC name: 2-amino-N-phenylpropanamide;hydrochloride. InChIKey: CTKPRJFRQXVQTG-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | 2-amino-N-phenylpropanamide;hydrochloride |
| InChIKey | CTKPRJFRQXVQTG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)