CAS 108413-55-4 is the registry number for 5-(3-Methoxyphenyl)-1,3,4-oxadiazole-2-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(3-methoxyphenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 108413-55-4) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: 5-(3-methoxyphenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: SCXBGYOKNHZERF-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 5-(3-methoxyphenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | SCXBGYOKNHZERF-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)