CAS 87829-34-3 is the registry number for (E)-3-(Amino(phenyl)methylene)-1-methyl-6-phenylpyridine-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(benzenecarboximidoyl)-4-hydroxy-1-methyl-6-phenylpyridin-2-one (CAS 87829-34-3) is a chemical compound with the molecular formula C19H16N2O2 and a molecular weight of 304.3 g/mol. IUPAC name: 3-(benzenecarboximidoyl)-4-hydroxy-1-methyl-6-phenylpyridin-2-one. InChIKey: WZKXUAOTZXJBRD-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O2 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 3-(benzenecarboximidoyl)-4-hydroxy-1-methyl-6-phenylpyridin-2-one |
| InChIKey | WZKXUAOTZXJBRD-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=C(C1=O)C(=N)C2=CC=CC=C2)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)