CAS 1086376-81-9 appears in our catalog under these names: 4-(2-Methyl-1,3-oxazol-4-yl)benzene-1-sulfonyl chloride, 95%, 4-(2-Methyl-1,3-oxazol-4-yl)benzene-1-sulfonyl Chloride, 4-(2-Methyloxazol-4-yl)benzene-1-sulfonyl chloride, 97%, 4-(2-Methyl-1,3-oxazol-4-yl)benzenesulfonyl chloride. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 500mg, 2,5g.
4-(2-methyl-1,3-oxazol-4-yl)benzenesulfonyl chloride (CAS 1086376-81-9) is a chemical compound with the molecular formula C10H8ClNO3S and a molecular weight of 257.69 g/mol. IUPAC name: 4-(2-methyl-1,3-oxazol-4-yl)benzenesulfonyl chloride. InChIKey: HPSZYMHIXLWICC-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3S |
|---|---|
| Molecular weight | 257.69 g/mol |
| IUPAC name | 4-(2-methyl-1,3-oxazol-4-yl)benzenesulfonyl chloride |
| InChIKey | HPSZYMHIXLWICC-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CO1)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)