Products 293306-72-6

CAS 293306-72-6 appears in our catalog under these names: 4-(2-Methyl-1,3-oxazol-5-yl)benzenesulfonyl chloride, 95%, 4-(2-Methyloxazol-5-yl)benzene-1-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(2-methyl-1,3-oxazol-5-yl)benzenesulfonyl chloride (CAS 293306-72-6) is a chemical compound with the molecular formula C10H8ClNO3S and a molecular weight of 257.69 g/mol. IUPAC name: 4-(2-methyl-1,3-oxazol-5-yl)benzenesulfonyl chloride. InChIKey: ACSNDJTZQWNDQK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClNO3S
Molecular weight257.69 g/mol
IUPAC name4-(2-methyl-1,3-oxazol-5-yl)benzenesulfonyl chloride
InChIKeyACSNDJTZQWNDQK-UHFFFAOYSA-N
SMILESCC1=NC=C(O1)C2=CC=C(C=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)