CAS 5765-40-2 appears in our catalog under these names: 5-(5-Isoxazolyl)-2-methylbenzenesulfonyl chloride, 95%, 5-(Isoxazol-5-yl)-2-methylbenzene-1-sulfonyl chloride, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, on request.
2-methyl-5-(1,2-oxazol-5-yl)benzenesulfonyl chloride (CAS 5765-40-2) is a chemical compound with the molecular formula C10H8ClNO3S and a molecular weight of 257.69 g/mol. IUPAC name: 2-methyl-5-(1,2-oxazol-5-yl)benzenesulfonyl chloride. InChIKey: GJTRZIMJBGXCIF-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3S |
|---|---|
| Molecular weight | 257.69 g/mol |
| IUPAC name | 2-methyl-5-(1,2-oxazol-5-yl)benzenesulfonyl chloride |
| InChIKey | GJTRZIMJBGXCIF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=NO2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)