CAS 7190-20-7 is the registry number for (6-Chloro-3-oxo-3,4-dihydro-2h-1,4-benzothiazin-2-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)acetic acid (CAS 7190-20-7) is a chemical compound with the molecular formula C10H8ClNO3S and a molecular weight of 257.69 g/mol. IUPAC name: 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)acetic acid. InChIKey: SKBFAHZHLILURA-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3S |
|---|---|
| Molecular weight | 257.69 g/mol |
| IUPAC name | 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)acetic acid |
| InChIKey | SKBFAHZHLILURA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=O)C(S2)CC(=O)O |
Computed by PubChem (NCBI)