Products 857283-56-8

CAS 857283-56-8 is the registry number for 5-Methyl-3-phenyl-4-isoxazolesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

5-methyl-3-phenyl-1,2-oxazole-4-sulfonyl chloride (CAS 857283-56-8) is a chemical compound with the molecular formula C10H8ClNO3S and a molecular weight of 257.69 g/mol. IUPAC name: 5-methyl-3-phenyl-1,2-oxazole-4-sulfonyl chloride. InChIKey: GXQBTNFENYVPFM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClNO3S
Molecular weight257.69 g/mol
IUPAC name5-methyl-3-phenyl-1,2-oxazole-4-sulfonyl chloride
InChIKeyGXQBTNFENYVPFM-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C2=CC=CC=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)