CAS 857283-56-8 is the registry number for 5-Methyl-3-phenyl-4-isoxazolesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-methyl-3-phenyl-1,2-oxazole-4-sulfonyl chloride (CAS 857283-56-8) is a chemical compound with the molecular formula C10H8ClNO3S and a molecular weight of 257.69 g/mol. IUPAC name: 5-methyl-3-phenyl-1,2-oxazole-4-sulfonyl chloride. InChIKey: GXQBTNFENYVPFM-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3S |
|---|---|
| Molecular weight | 257.69 g/mol |
| IUPAC name | 5-methyl-3-phenyl-1,2-oxazole-4-sulfonyl chloride |
| InChIKey | GXQBTNFENYVPFM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)