CAS 1160370-78-4 appears in our catalog under these names: 2-Hydroxy-4-methyl-6-quinolinesulfonyl chloride, 95%, 2-Hydroxy-4-methylquinoline-6-sulfonyl chloride 95%, 2-hydroxy-4-methyl-6-quinolinesulfonyl chloride, 98%, 2-Hydroxy-4-methylquinoline-6-sulfonyl chloride, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
4-methyl-2-oxo-1H-quinoline-6-sulfonyl chloride (CAS 1160370-78-4) is a chemical compound with the molecular formula C10H8ClNO3S and a molecular weight of 257.69 g/mol. IUPAC name: 4-methyl-2-oxo-1H-quinoline-6-sulfonyl chloride. InChIKey: NOEOALFXEBXCOA-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3S |
|---|---|
| Molecular weight | 257.69 g/mol |
| IUPAC name | 4-methyl-2-oxo-1H-quinoline-6-sulfonyl chloride |
| InChIKey | NOEOALFXEBXCOA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=C1C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)