CAS 1086385-71-8 is the registry number for 5-(3,4-Dimethoxyphenyl)-1,2,4-thiadiazol-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
5-(3,4-dimethoxyphenyl)-1,2,4-thiadiazol-3-amine (CAS 1086385-71-8) is a chemical compound with the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. IUPAC name: 5-(3,4-dimethoxyphenyl)-1,2,4-thiadiazol-3-amine. InChIKey: WDEDMMNPBVPGJS-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | 5-(3,4-dimethoxyphenyl)-1,2,4-thiadiazol-3-amine |
| InChIKey | WDEDMMNPBVPGJS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC(=NS2)N)OC |
Computed by PubChem (NCBI)