CAS 150208-26-7 appears in our catalog under these names: N-([5-(2-Amino-1,3-thiazol-4-yl)-2-furyl]methyl)acetamide, 95%, N-{(5-(2-amino-1,3-thiazol-4-yl)furan-2-yl)methyl}acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-[[5-(2-amino-1,3-thiazol-4-yl)furan-2-yl]methyl]acetamide (CAS 150208-26-7) is a chemical compound with the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. IUPAC name: N-[[5-(2-amino-1,3-thiazol-4-yl)furan-2-yl]methyl]acetamide. InChIKey: HMOORGLQDZENJJ-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | N-[[5-(2-amino-1,3-thiazol-4-yl)furan-2-yl]methyl]acetamide |
| InChIKey | HMOORGLQDZENJJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NCC1=CC=C(O1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)