CAS 338393-13-8 is the registry number for 4-Methylbenzyl 1h-1,2,4-triazol-3-yl sulfone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-[(4-methylphenyl)methylsulfonyl]-1H-1,2,4-triazole (CAS 338393-13-8) is a chemical compound with the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. IUPAC name: 5-[(4-methylphenyl)methylsulfonyl]-1H-1,2,4-triazole. InChIKey: YYQTWXHTIYSIRV-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | 5-[(4-methylphenyl)methylsulfonyl]-1H-1,2,4-triazole |
| InChIKey | YYQTWXHTIYSIRV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CS(=O)(=O)C2=NC=NN2 |
Computed by PubChem (NCBI)