CAS 112764-33-7 is the registry number for 5-(2,6-Dimethoxyphenyl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,6-dimethoxyphenyl)-1,3,4-thiadiazol-2-amine (CAS 112764-33-7) is a chemical compound with the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. IUPAC name: 5-(2,6-dimethoxyphenyl)-1,3,4-thiadiazol-2-amine. InChIKey: LVVJKSCZUBZUOF-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | 5-(2,6-dimethoxyphenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | LVVJKSCZUBZUOF-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)C2=NN=C(S2)N |
Computed by PubChem (NCBI)