Products 299932-63-1
CAS 299932-63-1 appears in our catalog under these names: 5-(2,4-Dimethoxyphenyl)-1,3,4-thiadiazol-2-amine, 95%, 5-(2,4-Dimethoxyphenyl)-1,3,4-thiadiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 250mg, 1g, 50mg, 0,5g.
5-(2,4-dimethoxyphenyl)-1,3,4-thiadiazol-2-amine (CAS 299932-63-1) is a chemical compound with the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. IUPAC name: 5-(2,4-dimethoxyphenyl)-1,3,4-thiadiazol-2-amine. InChIKey: AAUWKUOASVXTPN-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | 5-(2,4-dimethoxyphenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | AAUWKUOASVXTPN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=NN=C(S2)N)OC |
Computed by PubChem (NCBI)