CAS 5427-87-2 appears in our catalog under these names: 5-(3,4-Dimethoxyphenyl)-1,3,4-thiadiazol-2-amine, 95%, 5-(3,4-Dimethoxyphenyl)-1,3,4-thiadiazol-2-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
5-(3,4-dimethoxyphenyl)-1,3,4-thiadiazol-2-amine (CAS 5427-87-2) is a chemical compound with the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. IUPAC name: 5-(3,4-dimethoxyphenyl)-1,3,4-thiadiazol-2-amine. InChIKey: BQOCMHOWHOMIMJ-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | 5-(3,4-dimethoxyphenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | BQOCMHOWHOMIMJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NN=C(S2)N)OC |
Computed by PubChem (NCBI)