CAS 1086385-83-2 is the registry number for 5-(4-Fluorophenyl)-1,2,4-thiadiazol-3-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
5-(4-fluorophenyl)-1,2,4-thiadiazol-3-amine (CAS 1086385-83-2) is a chemical compound with the molecular formula C8H6FN3S and a molecular weight of 195.22 g/mol. IUPAC name: 5-(4-fluorophenyl)-1,2,4-thiadiazol-3-amine. InChIKey: MMIMNOLKKPZKTQ-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3S |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-1,2,4-thiadiazol-3-amine |
| InChIKey | MMIMNOLKKPZKTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NS2)N)F |
Computed by PubChem (NCBI)