CAS 114058-91-2 is the registry number for 5-(4-Fluorophenyl)-4h-1,2,4-triazole-3-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-(4-fluorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione (CAS 114058-91-2) is a chemical compound with the molecular formula C8H6FN3S and a molecular weight of 195.22 g/mol. IUPAC name: 5-(4-fluorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: YJFTVTOWNFZLSW-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3S |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | YJFTVTOWNFZLSW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=S)NN2)F |
Computed by PubChem (NCBI)