Products 874356-96-4
CAS 874356-96-4 is the registry number for 3-(4-Fluorophenyl)-1,2,4-thiadiazol-5-amine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-(4-fluorophenyl)-1,2,4-thiadiazol-5-amine (CAS 874356-96-4) is a chemical compound with the molecular formula C8H6FN3S and a molecular weight of 195.22 g/mol. IUPAC name: 3-(4-fluorophenyl)-1,2,4-thiadiazol-5-amine. InChIKey: UFUTXJNYAQSYKE-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3S |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-1,2,4-thiadiazol-5-amine |
| InChIKey | UFUTXJNYAQSYKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NSC(=N2)N)F |
Computed by PubChem (NCBI)