Products 59565-51-4
CAS 59565-51-4 appears in our catalog under these names: Anticonvulsant agent 3, Anticonvulsant agent 3 98%, 5-(2-Fluorophenyl)-1,3,4-thiadiazol-2-amine, 98%, 98%, Anticonvulsant agent 3, 99.64%, 5-(2-Fluoro-phenyl)-[1,3,4]thiadiazol-2-ylamine, 98%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 10mM (in 1ml dmso), 50mg, 250mg, 1g, 5g, 100 mg, 50 mg.
5-(2-fluorophenyl)-1,3,4-thiadiazol-2-amine (CAS 59565-51-4) is a chemical compound with the molecular formula C8H6FN3S and a molecular weight of 195.22 g/mol. IUPAC name: 5-(2-fluorophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: COIYYVXYSKVNIO-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3S |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | COIYYVXYSKVNIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=C(S2)N)F |
Computed by PubChem (NCBI)
Synonyms:
5-(2-Fluorophenyl)-1,3,4-thiadiazol-2-amine, 5-(2-Fluoro-phenyl)-[1,3,4]thiadiazol-2-ylamine, Anticonvulsant agent 3, 2-Amino-5-(2-fluorophenyl)-1,3,4-thiadiazole, 1,3,4-Thiadiazol-2-amine, 5-(2-fluorophenyl)-, 5-(2-fluorophenyl)-1,3,4-thiadiazol-2-ylamine, 5-(2-fluorophenyl)-1,3,4-thiadiazole-2-ylamine, Cambridge id 5539182, orb2567001, COIYYVXYSKVNIO-UHFFFAOYSA-N