CAS 59565-52-5 appears in our catalog under these names: 5-(3-Fluorophenyl)-1,3,4-thiadiazol-2-amine, 5-(3-Fluorophenyl)-1,3,4-thiadiazol-2-amine, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 25g, 5g, 1g.
5-(3-fluorophenyl)-1,3,4-thiadiazol-2-amine (CAS 59565-52-5) is a chemical compound with the molecular formula C8H6FN3S and a molecular weight of 195.22 g/mol. IUPAC name: 5-(3-fluorophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: HIUFXEMEPWWSHH-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3S |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 5-(3-fluorophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | HIUFXEMEPWWSHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NN=C(S2)N |
Computed by PubChem (NCBI)