CAS 929340-87-4 is the registry number for 4-(4-Fluorophenyl)-1,2,3-thiadiazol-5-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
4-(4-fluorophenyl)thiadiazol-5-amine (CAS 929340-87-4) is a chemical compound with the molecular formula C8H6FN3S and a molecular weight of 195.22 g/mol. IUPAC name: 4-(4-fluorophenyl)thiadiazol-5-amine. InChIKey: JOLABDYWSGUGAM-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3S |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 4-(4-fluorophenyl)thiadiazol-5-amine |
| InChIKey | JOLABDYWSGUGAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(SN=N2)N)F |
Computed by PubChem (NCBI)