Products 108664-99-9
CAS 108664-99-9 appears in our catalog under these names: 16–Oxokahweol, 16-Oxokahweol. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 10 mg, 1 mg.
12-methyl-8-oxapentacyclo[14.2.1.01,13.04,12.05,9]nonadeca-5(9),6,10-trien-17-one (CAS 108664-99-9) is a chemical compound with the molecular formula C19H22O2 and a molecular weight of 282.4 g/mol. IUPAC name: 12-methyl-8-oxapentacyclo[14.2.1.01,13.04,12.05,9]nonadeca-5(9),6,10-trien-17-one. InChIKey: ZUHATORLUREVSD-UHFFFAOYSA-N.
| Molecular formula | C19H22O2 |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 12-methyl-8-oxapentacyclo[14.2.1.01,13.04,12.05,9]nonadeca-5(9),6,10-trien-17-one |
| InChIKey | ZUHATORLUREVSD-UHFFFAOYSA-N |
| SMILES | CC12C=CC3=C(C1CCC45C2CCC(C4)C(=O)C5)C=CO3 |
Computed by PubChem (NCBI)