Products 108761-33-7
CAS 108761-33-7 appears in our catalog under these names: 6-Chloroindoxyl-1,3-diacetate, 95%, 6-Chloro-3-indolyl 1,3-diacetate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 100g, 25g, 1g, 50g, 250g.
(1-acetyl-6-chloroindol-3-yl) acetate (CAS 108761-33-7) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: (1-acetyl-6-chloroindol-3-yl) acetate. InChIKey: XOHGAYIKCAZFFX-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | (1-acetyl-6-chloroindol-3-yl) acetate |
| InChIKey | XOHGAYIKCAZFFX-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C=C(C2=C1C=C(C=C2)Cl)OC(=O)C |
Computed by PubChem (NCBI)