Products 923738-58-3
CAS 923738-58-3 appears in our catalog under these names: 3-[5-(2-Chlorophenyl)-1,3-oxazol-2-yl]propanoic acid, 95%, 3-(5-(2-Chlorophenyl)-1,3-oxazol-2-yl)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]propanoic acid (CAS 923738-58-3) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]propanoic acid. InChIKey: CYIOOFBFHBHUEN-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]propanoic acid |
| InChIKey | CYIOOFBFHBHUEN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CN=C(O2)CCC(=O)O)Cl |
Computed by PubChem (NCBI)