CAS 870704-00-0 appears in our catalog under these names: 5-(4-Chlorophenyl)isoxazole-3-propionic acid, 95%, 3-(5-(4-Chlorophenyl)isoxazol-3-yl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
3-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid (CAS 870704-00-0) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: 3-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid. InChIKey: RHKHSBMLUYKYIZ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | 3-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid |
| InChIKey | RHKHSBMLUYKYIZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)CCC(=O)O)Cl |
Computed by PubChem (NCBI)