Products 1820665-11-9
CAS 1820665-11-9 is the registry number for methyl 7-chloro-4-hydroxy-8-methylquinoline-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 7-chloro-8-methyl-4-oxo-1H-quinoline-3-carboxylate (CAS 1820665-11-9) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: methyl 7-chloro-8-methyl-4-oxo-1H-quinoline-3-carboxylate. InChIKey: GITBKYKQIHZZIZ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | methyl 7-chloro-8-methyl-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | GITBKYKQIHZZIZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1NC=C(C2=O)C(=O)OC)Cl |
Computed by PubChem (NCBI)