CAS 1087788-57-5 appears in our catalog under these names: 2,2,2-Trifluoroethyl N-(2,3-dimethylphenyl)carbamate, 95%, 2,2,2-Trifluoroethyl N-(2,3-dimethylphenyl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2,2,2-trifluoroethyl N-(2,3-dimethylphenyl)carbamate (CAS 1087788-57-5) is a chemical compound with the molecular formula C11H12F3NO2 and a molecular weight of 247.21 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(2,3-dimethylphenyl)carbamate. InChIKey: ONWRZQPIGJOUGY-UHFFFAOYSA-N.
| Molecular formula | C11H12F3NO2 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(2,3-dimethylphenyl)carbamate |
| InChIKey | ONWRZQPIGJOUGY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC(=O)OCC(F)(F)F)C |
Computed by PubChem (NCBI)