CAS 1087792-59-3 is the registry number for 4-{3,4,6-Trimethyl-1H-pyrazolo(3,4-b)pyridin-1-yl}aniline. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-(3,4,6-trimethylpyrazolo[5,4-b]pyridin-1-yl)aniline (CAS 1087792-59-3) is a chemical compound with the molecular formula C15H16N4 and a molecular weight of 252.31 g/mol. IUPAC name: 4-(3,4,6-trimethylpyrazolo[5,4-b]pyridin-1-yl)aniline. InChIKey: OOJZMFDZRYRLFF-UHFFFAOYSA-N.
| Molecular formula | C15H16N4 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 4-(3,4,6-trimethylpyrazolo[5,4-b]pyridin-1-yl)aniline |
| InChIKey | OOJZMFDZRYRLFF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=NN2C3=CC=C(C=C3)N)C)C |
Computed by PubChem (NCBI)