CAS 852940-52-4 appears in our catalog under these names: 5,6-Dimethyl-7-(3-methylphenyl)-7h-pyrrolo[2,3-d]pyrimidin-4-amine, 95%, 5,6-Dimethyl-7-(3-methylphenyl)-7H-pyrrolo(2,3-d)pyrimidin-4-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5,6-dimethyl-7-(3-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine (CAS 852940-52-4) is a chemical compound with the molecular formula C15H16N4 and a molecular weight of 252.31 g/mol. IUPAC name: 5,6-dimethyl-7-(3-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: PDGMDLPWPGHAPU-UHFFFAOYSA-N.
| Molecular formula | C15H16N4 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 5,6-dimethyl-7-(3-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | PDGMDLPWPGHAPU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=C(C3=C(N=CN=C32)N)C)C |
Computed by PubChem (NCBI)