Products 914636-24-1
CAS 914636-24-1 is the registry number for 2-Amino-3-(((4-(2-methylpropyl)phenyl)methylene)amino)-2-butenedinitrile. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
(Z)-2-amino-3-[[4-(2-methylpropyl)phenyl]methylideneamino]but-2-enedinitrile (CAS 914636-24-1) is a chemical compound with the molecular formula C15H16N4 and a molecular weight of 252.31 g/mol. IUPAC name: (Z)-2-amino-3-[[4-(2-methylpropyl)phenyl]methylideneamino]but-2-enedinitrile. InChIKey: ADVNRHLLJHJHMK-NZRAVRNTSA-N.
| Molecular formula | C15H16N4 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | (Z)-2-amino-3-[[4-(2-methylpropyl)phenyl]methylideneamino]but-2-enedinitrile |
| InChIKey | ADVNRHLLJHJHMK-NZRAVRNTSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C=N/C(=C(/C#N)\N)/C#N |
Computed by PubChem (NCBI)