CAS 938045-95-5 is the registry number for 6H,12H-5,11-Methanodibenzo[B,F][1,5]Diazocine-2,8-Diamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene-5,13-diamine (CAS 938045-95-5) is a chemical compound with the molecular formula C15H16N4 and a molecular weight of 252.31 g/mol. IUPAC name: 1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene-5,13-diamine. InChIKey: LRLKZMWOIWQJEF-UHFFFAOYSA-N.
| Molecular formula | C15H16N4 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene-5,13-diamine |
| InChIKey | LRLKZMWOIWQJEF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)N)N3CC4=C(N1C3)C=CC(=C4)N |
Computed by PubChem (NCBI)