CAS 40655-14-9 appears in our catalog under these names: 2–(4–(Dimethylamino)phenyl)–1H–benzo(d)imidazol–5–amine, 2-(4-(Dimethylamino)phenyl)-1H-benzo[d]imidazol-5-amine 95%, 2-(4-(Dimethylamino)phenyl)-1H-benzo[d]imidazol-5-amine, 95%, 95%, 2-(4-Dimethylamino-phenyl)-1 H -benzoimidazol-5-ylamine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[4-(dimethylamino)phenyl]-3H-benzimidazol-5-amine (CAS 40655-14-9) is a chemical compound with the molecular formula C15H16N4 and a molecular weight of 252.31 g/mol. IUPAC name: 2-[4-(dimethylamino)phenyl]-3H-benzimidazol-5-amine. InChIKey: MYBHZNWJSKGXNY-UHFFFAOYSA-N.
| Molecular formula | C15H16N4 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 2-[4-(dimethylamino)phenyl]-3H-benzimidazol-5-amine |
| InChIKey | MYBHZNWJSKGXNY-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC3=C(N2)C=C(C=C3)N |
Computed by PubChem (NCBI)