CAS 72578-43-9 appears in our catalog under these names: 5,6-Dimethyl-7-(p-tolyl)-7H-pyrrolo(2,3-d)pyrimidin-4-amine, 97%, 5,6-Dimethyl-7-(4-methylphenyl)-7H-pyrrolo(2,3-d)pyrimidin-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
5,6-dimethyl-7-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine (CAS 72578-43-9) is a chemical compound with the molecular formula C15H16N4 and a molecular weight of 252.31 g/mol. IUPAC name: 5,6-dimethyl-7-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: VXEPDEIQHWCDFQ-UHFFFAOYSA-N.
| Molecular formula | C15H16N4 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 5,6-dimethyl-7-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | VXEPDEIQHWCDFQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=C(C3=C(N=CN=C32)N)C)C |
Computed by PubChem (NCBI)