CAS 108831-68-1 appears in our catalog under these names: 4-Chloro-5,6-dimethylthieno[2,3-d]pyrimidine, 95%, 4-Chloro-5,6-dimethylthieno[2,3-d]pyrimidine 98%, 4-Chloro-5,6-dimethylthieno[2,3-d]pyrimidine, 95%, 95%, 4-Chloro-5,6-dimethylthieno[2,3-d]pyrimidine, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg, 10g.
4-chloro-5,6-dimethylthieno[2,3-d]pyrimidine (CAS 108831-68-1) is a chemical compound with the molecular formula C8H7ClN2S and a molecular weight of 198.67 g/mol. IUPAC name: 4-chloro-5,6-dimethylthieno[2,3-d]pyrimidine. InChIKey: HYOBKTVPACQCBR-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2S |
|---|---|
| Molecular weight | 198.67 g/mol |
| IUPAC name | 4-chloro-5,6-dimethylthieno[2,3-d]pyrimidine |
| InChIKey | HYOBKTVPACQCBR-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=NC=N2)Cl)C |
Computed by PubChem (NCBI)