CAS 1221931-63-0 is the registry number for 7-Chloro-2-methyl-1,3-benzothiazol-6-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
7-chloro-2-methyl-1,3-benzothiazol-6-amine (CAS 1221931-63-0) is a chemical compound with the molecular formula C8H7ClN2S and a molecular weight of 198.67 g/mol. IUPAC name: 7-chloro-2-methyl-1,3-benzothiazol-6-amine. InChIKey: VTIJAXOJIAYKHB-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2S |
|---|---|
| Molecular weight | 198.67 g/mol |
| IUPAC name | 7-chloro-2-methyl-1,3-benzothiazol-6-amine |
| InChIKey | VTIJAXOJIAYKHB-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C(=C(C=C2)N)Cl |
Computed by PubChem (NCBI)