CAS 50850-98-1 appears in our catalog under these names: 5-Chloro-6-methyl-1,3-benzothiazol-2-amine, 95%, 5-Chloro-6-methyl-benzothiazol-2-ylamine, 5-Chloro-6-methylbenzo[d]thiazol-2-amine. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 5g, 5mg, 25mg.
5-chloro-6-methyl-1,3-benzothiazol-2-amine (CAS 50850-98-1) is a chemical compound with the molecular formula C8H7ClN2S and a molecular weight of 198.67 g/mol. IUPAC name: 5-chloro-6-methyl-1,3-benzothiazol-2-amine. InChIKey: FFWBEOJHVGXEMJ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2S |
|---|---|
| Molecular weight | 198.67 g/mol |
| IUPAC name | 5-chloro-6-methyl-1,3-benzothiazol-2-amine |
| InChIKey | FFWBEOJHVGXEMJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Cl)N=C(S2)N |
Computed by PubChem (NCBI)