Products 1408074-92-9
CAS 1408074-92-9 appears in our catalog under these names: 4-Chloro-6-ethylthieno[3,2-d]pyrimidine, 95%, 6-Ethyl-4-chlorothieno(3,2-d)pyrimidine, 97%, 4-chloro-6-ethylthieno[3,2-d]pyrimidine, 97%, 97%, 6-ETHYL-4-CHLOROTHIENO[3,2-D]PYRIMIDINE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg.
4-chloro-6-ethylthieno[3,2-d]pyrimidine (CAS 1408074-92-9) is a chemical compound with the molecular formula C8H7ClN2S and a molecular weight of 198.67 g/mol. IUPAC name: 4-chloro-6-ethylthieno[3,2-d]pyrimidine. InChIKey: NGDXZQYZVYWVLN-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2S |
|---|---|
| Molecular weight | 198.67 g/mol |
| IUPAC name | 4-chloro-6-ethylthieno[3,2-d]pyrimidine |
| InChIKey | NGDXZQYZVYWVLN-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(S1)C(=NC=N2)Cl |
Computed by PubChem (NCBI)