CAS 383131-41-7 is the registry number for 4-Chloro-6-methyl-1,3-benzothiazol-2-amine, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.
4-chloro-6-methyl-1,3-benzothiazol-2-amine (CAS 383131-41-7) is a chemical compound with the molecular formula C8H7ClN2S and a molecular weight of 198.67 g/mol. IUPAC name: 4-chloro-6-methyl-1,3-benzothiazol-2-amine. InChIKey: UKZNGVGJUJBHEN-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2S |
|---|---|
| Molecular weight | 198.67 g/mol |
| IUPAC name | 4-chloro-6-methyl-1,3-benzothiazol-2-amine |
| InChIKey | UKZNGVGJUJBHEN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)Cl)N=C(S2)N |
Computed by PubChem (NCBI)