CAS 126920-72-7 is the registry number for 4-Chloro-7-methylbenzo[d]thiazol-2-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-7-methyl-1,3-benzothiazol-2-amine (CAS 126920-72-7) is a chemical compound with the molecular formula C8H7ClN2S and a molecular weight of 198.67 g/mol. IUPAC name: 4-chloro-7-methyl-1,3-benzothiazol-2-amine. InChIKey: PFEQJVDKGKSNNW-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2S |
|---|---|
| Molecular weight | 198.67 g/mol |
| IUPAC name | 4-chloro-7-methyl-1,3-benzothiazol-2-amine |
| InChIKey | PFEQJVDKGKSNNW-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Cl)N=C(S2)N |
Computed by PubChem (NCBI)