CAS 1089303-25-2 appears in our catalog under these names: 4-(4-Chlorophenyl)-3,3-dimethylbutanoic acid, 95%, 4-(4-Chlorophenyl)-3,3-dimethylbutanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(4-chlorophenyl)-3,3-dimethylbutanoic acid (CAS 1089303-25-2) is a chemical compound with the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. IUPAC name: 4-(4-chlorophenyl)-3,3-dimethylbutanoic acid. InChIKey: VFYGTRVUHKQCKG-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO2 |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-3,3-dimethylbutanoic acid |
| InChIKey | VFYGTRVUHKQCKG-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=C(C=C1)Cl)CC(=O)O |
Computed by PubChem (NCBI)