CAS 1090344-11-8 is the registry number for 2,3-Dichloro-N-ethylbenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,3-dichloro-N-ethylbenzamide (CAS 1090344-11-8) is a chemical compound with the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. IUPAC name: 2,3-dichloro-N-ethylbenzamide. InChIKey: XLIWICYILPTDAW-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | 2,3-dichloro-N-ethylbenzamide |
| InChIKey | XLIWICYILPTDAW-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)