CAS 1090858-69-7 is the registry number for 1-(2-Hydroxyethyl)-5-nitro-1,2-dihydropyridin-2-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-(2-hydroxyethyl)-5-nitropyridin-2-one (CAS 1090858-69-7) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 1-(2-hydroxyethyl)-5-nitropyridin-2-one. InChIKey: GPJOPFUPJAWPCQ-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 1-(2-hydroxyethyl)-5-nitropyridin-2-one |
| InChIKey | GPJOPFUPJAWPCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C=C1[N+](=O)[O-])CCO |
Computed by PubChem (NCBI)