CAS 708285-81-8 is the registry number for 1–((3–Methoxyphenyl)sulfonamido)cyclohexane–1–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 50mg.
1-[(3-methoxyphenyl)sulfonylamino]cyclohexane-1-carboxylic acid (CAS 708285-81-8) is a chemical compound with the molecular formula C14H19NO5S and a molecular weight of 313.37 g/mol. IUPAC name: 1-[(3-methoxyphenyl)sulfonylamino]cyclohexane-1-carboxylic acid. InChIKey: JYRASMNKLRBLFE-UHFFFAOYSA-N.
| Molecular formula | C14H19NO5S |
|---|---|
| Molecular weight | 313.37 g/mol |
| IUPAC name | 1-[(3-methoxyphenyl)sulfonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | JYRASMNKLRBLFE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC=C1)S(=O)(=O)NC2(CCCCC2)C(=O)O |
Computed by PubChem (NCBI)