Products 1092108-79-6
CAS 1092108-79-6 appears in our catalog under these names: 3–(3，4–Dichlorophenyl)pyrrolidine hydrochloride, 3-(3,4-Dichlorophenyl)pyrrolidine hydrochloride, 95%, 95%, 3-(3,4-Dichlorophenyl)pyrrolidine hydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg.
3-(3,4-dichlorophenyl)pyrrolidine;hydrochloride (CAS 1092108-79-6) is a chemical compound with the molecular formula C10H12Cl3N and a molecular weight of 252.6 g/mol. IUPAC name: 3-(3,4-dichlorophenyl)pyrrolidine;hydrochloride. InChIKey: CLEBEYWTFWLKQX-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3N |
|---|---|
| Molecular weight | 252.6 g/mol |
| IUPAC name | 3-(3,4-dichlorophenyl)pyrrolidine;hydrochloride |
| InChIKey | CLEBEYWTFWLKQX-UHFFFAOYSA-N |
| SMILES | C1CNCC1C2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)