CAS 1807937-71-8 appears in our catalog under these names: (1R,3r)-3-(3,4-dichlorophenyl)cyclobutan-1-amine hydrochloride, 95%, rac-(1R,3R)-3-(3,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(3,4-dichlorophenyl)cyclobutan-1-amine;hydrochloride (CAS 1807937-71-8) is a chemical compound with the molecular formula C10H12Cl3N and a molecular weight of 252.6 g/mol. IUPAC name: 3-(3,4-dichlorophenyl)cyclobutan-1-amine;hydrochloride. InChIKey: MGDXWGQMJJBHLK-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3N |
|---|---|
| Molecular weight | 252.6 g/mol |
| IUPAC name | 3-(3,4-dichlorophenyl)cyclobutan-1-amine;hydrochloride |
| InChIKey | MGDXWGQMJJBHLK-UHFFFAOYSA-N |
| SMILES | C1C(CC1N)C2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)