CAS 1260763-07-2 appears in our catalog under these names: N-(2,3-Dichlorobenzyl)cyclopropanamine hydrochloride, 98%, N-(2,3-dichlorobenzyl)cyclopropanamine (Hydrochloride), 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
N-[(2,3-dichlorophenyl)methyl]cyclopropanamine;hydrochloride (CAS 1260763-07-2) is a chemical compound with the molecular formula C10H12Cl3N and a molecular weight of 252.6 g/mol. IUPAC name: N-[(2,3-dichlorophenyl)methyl]cyclopropanamine;hydrochloride. InChIKey: PSGVXVWMSBMJDZ-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3N |
|---|---|
| Molecular weight | 252.6 g/mol |
| IUPAC name | N-[(2,3-dichlorophenyl)methyl]cyclopropanamine;hydrochloride |
| InChIKey | PSGVXVWMSBMJDZ-UHFFFAOYSA-N |
| SMILES | C1CC1NCC2=C(C(=CC=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)