Products 1092288-48-6

CAS 1092288-48-6 is the registry number for 7,8-Dimethylquinoline-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

7,8-dimethylquinoline-4-carboxylic acid (CAS 1092288-48-6) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 7,8-dimethylquinoline-4-carboxylic acid. InChIKey: FROOOGKOFBRASO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO2
Molecular weight201.22 g/mol
IUPAC name7,8-dimethylquinoline-4-carboxylic acid
InChIKeyFROOOGKOFBRASO-UHFFFAOYSA-N
SMILESCC1=C(C2=NC=CC(=C2C=C1)C(=O)O)C

Computed by PubChem (NCBI)