CAS 1092288-48-6 is the registry number for 7,8-Dimethylquinoline-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7,8-dimethylquinoline-4-carboxylic acid (CAS 1092288-48-6) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 7,8-dimethylquinoline-4-carboxylic acid. InChIKey: FROOOGKOFBRASO-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 7,8-dimethylquinoline-4-carboxylic acid |
| InChIKey | FROOOGKOFBRASO-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC=CC(=C2C=C1)C(=O)O)C |
Computed by PubChem (NCBI)