CAS 1092345-74-8 is the registry number for 3-Amino-6-bromo-8-methyl-3,4-dihydroquinazolin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-amino-6-bromo-8-methylquinazolin-4-one (CAS 1092345-74-8) is a chemical compound with the molecular formula C9H8BrN3O and a molecular weight of 254.08 g/mol. IUPAC name: 3-amino-6-bromo-8-methylquinazolin-4-one. InChIKey: TXJLOOMQBAFRGK-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3O |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 3-amino-6-bromo-8-methylquinazolin-4-one |
| InChIKey | TXJLOOMQBAFRGK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N=CN(C2=O)N)Br |
Computed by PubChem (NCBI)